About [(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite
[(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite (PubChem CID 143418746) has the molecular formula C9H12ClNO
and a molecular weight of 185.65 g/mol. Its IUPAC name is [(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite.
Molecular Properties
| Compound Name | [(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite |
| PubChem CID | 143418746 |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | [(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite |
| SMILES | C=C/C(=C\C1=CN(C)CC1)OCl |
| InChI | InChI=1S/C9H12ClNO/c1-3-9(12-10)6-8-4-5-11(2)7-8/h3,6-7H,1,4-5H2,2H3/b9-6+ |
| InChIKey | RTFGGLBSLUADPM-RMKNXTFCSA-N |
| XLogP | 2.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite?
The IUPAC name of [(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite (CID 143418746) is [(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite.
What is the SMILES notation for [(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite?
The canonical SMILES for [(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite is C=C/C(=C\C1=CN(C)CC1)OCl.
What is the InChIKey of [(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite?
The InChIKey is RTFGGLBSLUADPM-RMKNXTFCSA-N. The full InChI is InChI=1S/C9H12ClNO/c1-3-9(12-10)6-8-4-5-11(2)7-8/h3,6-7H,1,4-5H2,2H3/b9-6+.
What are the key properties of [(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite?
[(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite has a molecular weight of 185.65 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E)-1-(1-methyl-2,3-dihydropyrrol-4-yl)buta-1,3-dien-2-yl] hypochlorite is sourced from PubChem (CID 143418746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).