C13H24OSi — CID 134966621
(4E)-4-(2,2-dimethylpropylidene)-2,2,6-trimethyl-3-methylideneoxasilinane (PubChem CID 134966621) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is (4E)-4-(2,2-dimethylpropylidene)-2,2,6-trimethyl-3-methylideneoxasilinane.
| Compound Name | (4E)-4-(2,2-dimethylpropylidene)-2,2,6-trimethyl-3-methylideneoxasilinane |
|---|---|
| PubChem CID | 134966621 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (4E)-4-(2,2-dimethylpropylidene)-2,2,6-trimethyl-3-methylideneoxasilinane |
| SMILES | C=C1/C(=C/C(C)(C)C)CC(C)O[Si]1(C)C |
| InChI | InChI=1S/C13H24OSi/c1-10-8-12(9-13(3,4)5)11(2)15(6,7)14-10/h9-10H,2,8H2,1,3-7H3/b12-9+ |
| InChIKey | BDQALQOLLIWHTN-FMIVXFBMSA-N |
| XLogP | 4.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|