C13H22O3 — CID 134966650
ethyl (2R)-2-[(S)-cyclohexyl(hydroxy)methyl]but-3-enoate (PubChem CID 134966650) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is ethyl (2R)-2-[(S)-cyclohexyl(hydroxy)methyl]but-3-enoate.
| Compound Name | ethyl (2R)-2-[(S)-cyclohexyl(hydroxy)methyl]but-3-enoate |
|---|---|
| PubChem CID | 134966650 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | ethyl (2R)-2-[(S)-cyclohexyl(hydroxy)methyl]but-3-enoate |
| SMILES | C=C[C@@H](C(=O)OCC)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C13H22O3/c1-3-11(13(15)16-4-2)12(14)10-8-6-5-7-9-10/h3,10-12,14H,1,4-9H2,2H3/t11-,12+/m1/s1 |
| InChIKey | TZYINAIWKRIOOG-NEPJUHHUSA-N |
| XLogP | 2.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|