About 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid
7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid (PubChem CID 71528000) has the molecular formula C15H22O5
and a molecular weight of 282.34 g/mol. Its IUPAC name is 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid.
Molecular Properties
| Compound Name | 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid |
| PubChem CID | 71528000 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid |
| SMILES | C=CC(C=C)OC(=O)C(CCCCC(=O)O)C(O)C=C |
| InChI | InChI=1S/C15H22O5/c1-4-11(5-2)20-15(19)12(13(16)6-3)9-7-8-10-14(17)18/h4-6,11-13,16H,1-3,7-10H2,(H,17,18) |
| InChIKey | CORIOEKLTREQDY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid?
The IUPAC name of 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid (CID 71528000) is 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid.
What is the SMILES notation for 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid?
The canonical SMILES for 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid is C=CC(C=C)OC(=O)C(CCCCC(=O)O)C(O)C=C.
What is the InChIKey of 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid?
The InChIKey is CORIOEKLTREQDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O5/c1-4-11(5-2)20-15(19)12(13(16)6-3)9-7-8-10-14(17)18/h4-6,11-13,16H,1-3,7-10H2,(H,17,18).
What are the key properties of 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid?
7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid has a molecular weight of 282.34 g/mol, XLogP of 2.08, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid is sourced from PubChem (CID 71528000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).