C15H22O5 — CID 71528000
7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid (PubChem CID 71528000) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid.
| Compound Name | 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid |
|---|---|
| PubChem CID | 71528000 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 7-hydroxy-6-penta-1,4-dien-3-yloxycarbonylnon-8-enoic acid |
| SMILES | C=CC(C=C)OC(=O)C(CCCCC(=O)O)C(O)C=C |
| InChI | InChI=1S/C15H22O5/c1-4-11(5-2)20-15(19)12(13(16)6-3)9-7-8-10-14(17)18/h4-6,11-13,16H,1-3,7-10H2,(H,17,18) |
| InChIKey | CORIOEKLTREQDY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|