C13H22O3 — CID 101459009
(2S)-2-[(2S,5S,6S)-6-[(2R)-but-3-en-2-yl]-5-methyloxan-2-yl]propanoic acid (PubChem CID 101459009) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (2S)-2-[(2S,5S,6S)-6-[(2R)-but-3-en-2-yl]-5-methyloxan-2-yl]propanoic acid.
| Compound Name | (2S)-2-[(2S,5S,6S)-6-[(2R)-but-3-en-2-yl]-5-methyloxan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 101459009 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (2S)-2-[(2S,5S,6S)-6-[(2R)-but-3-en-2-yl]-5-methyloxan-2-yl]propanoic acid |
| SMILES | C=C[C@@H](C)[C@H]1O[C@H]([C@H](C)C(=O)O)CC[C@@H]1C |
| InChI | InChI=1S/C13H22O3/c1-5-8(2)12-9(3)6-7-11(16-12)10(4)13(14)15/h5,8-12H,1,6-7H2,2-4H3,(H,14,15)/t8-,9+,10+,11+,12-/m1/s1 |
| InChIKey | KAMRDMQYESOUHD-WTPMCQDGSA-N |
| XLogP | 2.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|