C10H16O — CID 134966693
(2S)-2-(4-methylcyclohexa-1,3-dien-1-yl)propan-1-ol (PubChem CID 134966693) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (2S)-2-(4-methylcyclohexa-1,3-dien-1-yl)propan-1-ol.
| Compound Name | (2S)-2-(4-methylcyclohexa-1,3-dien-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 134966693 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2S)-2-(4-methylcyclohexa-1,3-dien-1-yl)propan-1-ol |
| SMILES | CC1=CC=C([C@H](C)CO)CC1 |
| InChI | InChI=1S/C10H16O/c1-8-3-5-10(6-4-8)9(2)7-11/h3,5,9,11H,4,6-7H2,1-2H3/t9-/m1/s1 |
| InChIKey | HJVQCSCYUKRTCP-SECBINFHSA-N |
| XLogP | 2.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |