C17H30O3 — CID 134966706
(3E,7E)-10-[(2S,3S)-3-(hydroxymethyl)-2-methyloxiran-2-yl]-2,3,7-trimethyldeca-3,7-dien-2-ol (PubChem CID 134966706) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (3E,7E)-10-[(2S,3S)-3-(hydroxymethyl)-2-methyloxiran-2-yl]-2,3,7-trimethyldeca-3,7-dien-2-ol.
| Compound Name | (3E,7E)-10-[(2S,3S)-3-(hydroxymethyl)-2-methyloxiran-2-yl]-2,3,7-trimethyldeca-3,7-dien-2-ol |
|---|---|
| PubChem CID | 134966706 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (3E,7E)-10-[(2S,3S)-3-(hydroxymethyl)-2-methyloxiran-2-yl]-2,3,7-trimethyldeca-3,7-dien-2-ol |
| SMILES | C/C(=C\CC[C@]1(C)O[C@H]1CO)CC/C=C(\C)C(C)(C)O |
| InChI | InChI=1S/C17H30O3/c1-13(8-6-10-14(2)16(3,4)19)9-7-11-17(5)15(12-18)20-17/h9-10,15,18-19H,6-8,11-12H2,1-5H3/b13-9+,14-10+/t15-,17-/m0/s1 |
| InChIKey | QIZBNFVGHZCDRU-IZSAZWEKSA-N |
| XLogP | 3.36 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|