About (1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one
(1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one (PubChem CID 134967255) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is (1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one.
Molecular Properties
| Compound Name | (1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one |
| PubChem CID | 134967255 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one |
| SMILES | CCN1C(=O)[C@]2(C)C[C@@H]2c2ccccc21 |
| InChI | InChI=1S/C13H15NO/c1-3-14-11-7-5-4-6-9(11)10-8-13(10,2)12(14)15/h4-7,10H,3,8H2,1-2H3/t10-,13-/m1/s1 |
| InChIKey | PMFLLFRFYNCMSY-ZWNOBZJWSA-N |
| XLogP | 2.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one?
The IUPAC name of (1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one (CID 134967255) is (1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one.
What is the SMILES notation for (1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one?
The canonical SMILES for (1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one is CCN1C(=O)[C@]2(C)C[C@@H]2c2ccccc21.
What is the InChIKey of (1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one?
The InChIKey is PMFLLFRFYNCMSY-ZWNOBZJWSA-N. The full InChI is InChI=1S/C13H15NO/c1-3-14-11-7-5-4-6-9(11)10-8-13(10,2)12(14)15/h4-7,10H,3,8H2,1-2H3/t10-,13-/m1/s1.
What are the key properties of (1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one?
(1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one has a molecular weight of 201.27 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1aR,7bR)-3-ethyl-1a-methyl-1,7b-dihydrocyclopropa[c]quinolin-2-one is sourced from PubChem (CID 134967255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).