C16H14BrFO — CID 134967923
(1S,2R)-1-(4-bromophenyl)-2-(4-fluorophenyl)but-3-en-1-ol (PubChem CID 134967923) has the molecular formula C16H14BrFO and a molecular weight of 321.19 g/mol. Its IUPAC name is (1S,2R)-1-(4-bromophenyl)-2-(4-fluorophenyl)but-3-en-1-ol.
| Compound Name | (1S,2R)-1-(4-bromophenyl)-2-(4-fluorophenyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 134967923 |
| Molecular Formula | C16H14BrFO |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | (1S,2R)-1-(4-bromophenyl)-2-(4-fluorophenyl)but-3-en-1-ol |
| SMILES | C=C[C@H](c1ccc(F)cc1)[C@H](O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14BrFO/c1-2-15(11-5-9-14(18)10-6-11)16(19)12-3-7-13(17)8-4-12/h2-10,15-16,19H,1H2/t15-,16-/m1/s1 |
| InChIKey | KUWZVMSHVAGVQR-HZPDHXFCSA-N |
| XLogP | 4.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|