C14H16N2S — CID 134968046
2-cyclohexyl-5-phenyl-1,3,4-thiadiazole (PubChem CID 134968046) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 2-cyclohexyl-5-phenyl-1,3,4-thiadiazole.
| Compound Name | 2-cyclohexyl-5-phenyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 134968046 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-cyclohexyl-5-phenyl-1,3,4-thiadiazole |
| SMILES | c1ccc(-c2nnc(C3CCCCC3)s2)cc1 |
| InChI | InChI=1S/C14H16N2S/c1-3-7-11(8-4-1)13-15-16-14(17-13)12-9-5-2-6-10-12/h1,3-4,7-8,12H,2,5-6,9-10H2 |
| InChIKey | BLYMYYYZOMTDOC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |