C15H24O2 — CID 134968539
3-methyl-3-[(2E,6Z)-nona-2,6-dienyl]pentane-2,4-dione (PubChem CID 134968539) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 3-methyl-3-[(2E,6Z)-nona-2,6-dienyl]pentane-2,4-dione.
| Compound Name | 3-methyl-3-[(2E,6Z)-nona-2,6-dienyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 134968539 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 3-methyl-3-[(2E,6Z)-nona-2,6-dienyl]pentane-2,4-dione |
| SMILES | CC/C=C\CC/C=C/CC(C)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C15H24O2/c1-5-6-7-8-9-10-11-12-15(4,13(2)16)14(3)17/h6-7,10-11H,5,8-9,12H2,1-4H3/b7-6-,11-10+ |
| InChIKey | RDYJBLZDVMWLPT-JFEAUALZSA-N |
| XLogP | 3.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|