C15H24O3 — CID 134968811
(3R,6R,8S)-11-[(2S)-1-hydroxypropan-2-yl]-8-methyltetracyclo[5.4.0.02,5.03,8]undecane-3,6-diol (PubChem CID 134968811) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (3R,6R,8S)-11-[(2S)-1-hydroxypropan-2-yl]-8-methyltetracyclo[5.4.0.02,5.03,8]undecane-3,6-diol.
| Compound Name | (3R,6R,8S)-11-[(2S)-1-hydroxypropan-2-yl]-8-methyltetracyclo[5.4.0.02,5.03,8]undecane-3,6-diol |
|---|---|
| PubChem CID | 134968811 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3R,6R,8S)-11-[(2S)-1-hydroxypropan-2-yl]-8-methyltetracyclo[5.4.0.02,5.03,8]undecane-3,6-diol |
| SMILES | C[C@H](CO)C1CC[C@@]2(C)C3C(O)C4C[C@@]2(O)C4C13 |
| InChI | InChI=1S/C15H24O3/c1-7(6-16)8-3-4-14(2)12-10(8)11-9(13(12)17)5-15(11,14)18/h7-13,16-18H,3-6H2,1-2H3/t7-,8?,9?,10?,11?,12?,13?,14+,15-/m1/s1 |
| InChIKey | SJXNXMWZQQHCHW-CTKSVLSBSA-N |
| XLogP | 1.02 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |