C15H24O3 — CID 10944915
(1'S,2S,2'R,3'R,6'S,8'S,9'R,10'S)-6'-methyl-3'-propan-2-ylspiro[oxirane-2,7'-tricyclo[4.4.0.02,8]decane]-9',10'-diol (PubChem CID 10944915) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1'S,2S,2'R,3'R,6'S,8'S,9'R,10'S)-6'-methyl-3'-propan-2-ylspiro[oxirane-2,7'-tricyclo[4.4.0.02,8]decane]-9',10'-diol.
| Compound Name | (1'S,2S,2'R,3'R,6'S,8'S,9'R,10'S)-6'-methyl-3'-propan-2-ylspiro[oxirane-2,7'-tricyclo[4.4.0.02,8]decane]-9',10'-diol |
|---|---|
| PubChem CID | 10944915 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1'S,2S,2'R,3'R,6'S,8'S,9'R,10'S)-6'-methyl-3'-propan-2-ylspiro[oxirane-2,7'-tricyclo[4.4.0.02,8]decane]-9',10'-diol |
| SMILES | CC(C)[C@H]1CC[C@@]2(C)[C@H]3[C@H](O)[C@H](O)[C@H]([C@@H]31)[C@@]21CO1 |
| InChI | InChI=1S/C15H24O3/c1-7(2)8-4-5-14(3)10-9(8)11(13(17)12(10)16)15(14)6-18-15/h7-13,16-17H,4-6H2,1-3H3/t8-,9-,10-,11+,12+,13-,14+,15+/m1/s1 |
| InChIKey | VHMNAPBFMHCKLZ-MZKUERFNSA-N |
| XLogP | 1.43 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|