C16H20N2 — CID 134968939
1-phenyl-1-N'-[(1R)-1-phenylethyl]ethane-1,1-diamine (PubChem CID 134968939) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-phenyl-1-N'-[(1R)-1-phenylethyl]ethane-1,1-diamine.
| Compound Name | 1-phenyl-1-N'-[(1R)-1-phenylethyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 134968939 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-phenyl-1-N'-[(1R)-1-phenylethyl]ethane-1,1-diamine |
| SMILES | C[C@@H](NC(C)(N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H20N2/c1-13(14-9-5-3-6-10-14)18-16(2,17)15-11-7-4-8-12-15/h3-13,18H,17H2,1-2H3/t13-,16?/m1/s1 |
| InChIKey | QWTBRBHQASWSPP-JBZHPUCOSA-N |
| XLogP | 3.17 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|