C12H21F3O3P+ — CID 134969378
[(E)-dec-6-en-5-yl]oxy-oxo-(2,2,2-trifluoroethoxy)phosphanium (PubChem CID 134969378) has the molecular formula C12H21F3O3P+ and a molecular weight of 301.27 g/mol. Its IUPAC name is [(E)-dec-6-en-5-yl]oxy-oxo-(2,2,2-trifluoroethoxy)phosphanium.
| Compound Name | [(E)-dec-6-en-5-yl]oxy-oxo-(2,2,2-trifluoroethoxy)phosphanium |
|---|---|
| PubChem CID | 134969378 |
| Molecular Formula | C12H21F3O3P+ |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | [(E)-dec-6-en-5-yl]oxy-oxo-(2,2,2-trifluoroethoxy)phosphanium |
| SMILES | CCC/C=C/C(CCCC)O[P+](=O)OCC(F)(F)F |
| InChI | InChI=1S/C12H21F3O3P/c1-3-5-7-9-11(8-6-4-2)18-19(16)17-10-12(13,14)15/h7,9,11H,3-6,8,10H2,1-2H3/q+1/b9-7+ |
| InChIKey | QFSALIGVKOKIGZ-VQHVLOKHSA-N |
| XLogP | 5.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|