C24H42O6Si — CID 134969883
ethyl (6S,8R,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-5,5,9-trimethyl-4-oxo-8-propan-2-yl-1,7-dioxaspiro[5.5]undec-2-ene-2-carboxylate (PubChem CID 134969883) has the molecular formula C24H42O6Si and a molecular weight of 454.68 g/mol. Its IUPAC name is ethyl (6S,8R,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-5,5,9-trimethyl-4-oxo-8-propan-2-yl-1,7-dioxaspiro[5.5]undec-2-ene-2-carboxylate.
| Compound Name | ethyl (6S,8R,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-5,5,9-trimethyl-4-oxo-8-propan-2-yl-1,7-dioxaspiro[5.5]undec-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 134969883 |
| Molecular Formula | C24H42O6Si |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | ethyl (6S,8R,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-5,5,9-trimethyl-4-oxo-8-propan-2-yl-1,7-dioxaspiro[5.5]undec-2-ene-2-carboxylate |
| SMILES | CCOC(=O)C1=CC(=O)C(C)(C)[C@]2(C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](C(C)C)O2)O1 |
| InChI | InChI=1S/C24H42O6Si/c1-12-27-21(26)17-13-19(25)23(8,9)24(28-17)14-18(16(4)20(29-24)15(2)3)30-31(10,11)22(5,6)7/h13,15-16,18,20H,12,14H2,1-11H3/t16-,18+,20+,24+/m0/s1 |
| InChIKey | HSHADDHFWGKMQD-XXDRUXBBSA-N |
| XLogP | 5.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|