C23H42O7Si — CID 11351598
ethyl (Z)-5-[(2R,4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-methyl-6-propan-2-yloxan-2-yl]-2-hydroxy-4-oxopent-2-enoate (PubChem CID 11351598) has the molecular formula C23H42O7Si and a molecular weight of 458.67 g/mol. Its IUPAC name is ethyl (Z)-5-[(2R,4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-methyl-6-propan-2-yloxan-2-yl]-2-hydroxy-4-oxopent-2-enoate.
| Compound Name | ethyl (Z)-5-[(2R,4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-methyl-6-propan-2-yloxan-2-yl]-2-hydroxy-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 11351598 |
| Molecular Formula | C23H42O7Si |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | ethyl (Z)-5-[(2R,4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-methyl-6-propan-2-yloxan-2-yl]-2-hydroxy-4-oxopent-2-enoate |
| SMILES | CCOC(=O)/C(O)=C/C(=O)C[C@@]1(OC)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C23H42O7Si/c1-11-28-21(26)18(25)12-17(24)13-23(27-8)14-19(16(4)20(29-23)15(2)3)30-31(9,10)22(5,6)7/h12,15-16,19-20,25H,11,13-14H2,1-10H3/b18-12-/t16-,19+,20+,23-/m0/s1 |
| InChIKey | MGXJNZLUZULFAK-YXHBYOJQSA-N |
| XLogP | 4.76 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|