C27H52O7Si2 — CID 102031469
(1S,5S,7E,9R,10R,11S,12S,13S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hydroxy-9-methoxy-7,10,12-trimethyl-13-trimethylsilyloxy-4,15-dioxabicyclo[9.3.1]pentadec-7-en-3-one (PubChem CID 102031469) has the molecular formula C27H52O7Si2 and a molecular weight of 544.88 g/mol. Its IUPAC name is (1S,5S,7E,9R,10R,11S,12S,13S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hydroxy-9-methoxy-7,10,12-trimethyl-13-trimethylsilyloxy-4,15-dioxabicyclo[9.3.1]pentadec-7-en-3-one.
| Compound Name | (1S,5S,7E,9R,10R,11S,12S,13S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hydroxy-9-methoxy-7,10,12-trimethyl-13-trimethylsilyloxy-4,15-dioxabicyclo[9.3.1]pentadec-7-en-3-one |
|---|---|
| PubChem CID | 102031469 |
| Molecular Formula | C27H52O7Si2 |
| Molecular Weight | 544.88 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | (1S,5S,7E,9R,10R,11S,12S,13S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hydroxy-9-methoxy-7,10,12-trimethyl-13-trimethylsilyloxy-4,15-dioxabicyclo[9.3.1]pentadec-7-en-3-one |
| SMILES | CO[C@@H]1/C=C(\C)C[C@@H](CO[Si](C)(C)C(C)(C)C)OC(=O)C[C@]2(O)C[C@H](O[Si](C)(C)C)[C@@H](C)[C@@H](O2)[C@@H]1C |
| InChI | InChI=1S/C27H52O7Si2/c1-18-13-21(17-31-36(11,12)26(4,5)6)32-24(28)16-27(29)15-23(34-35(8,9)10)20(3)25(33-27)19(2)22(14-18)30-7/h14,19-23,25,29H,13,15-17H2,1-12H3/b18-14+/t19-,20-,21+,22-,23+,25+,27+/m1/s1 |
| InChIKey | HGIMREAYSPKWCN-XIBBQZGOSA-N |
| XLogP | 5.64 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.88 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|