C13H24O — CID 134970135
[(1R,3R)-1-cyclohexyl-3-methylcyclopentyl]methanol (PubChem CID 134970135) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is [(1R,3R)-1-cyclohexyl-3-methylcyclopentyl]methanol.
| Compound Name | [(1R,3R)-1-cyclohexyl-3-methylcyclopentyl]methanol |
|---|---|
| PubChem CID | 134970135 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | [(1R,3R)-1-cyclohexyl-3-methylcyclopentyl]methanol |
| SMILES | C[C@@H]1CC[C@](CO)(C2CCCCC2)C1 |
| InChI | InChI=1S/C13H24O/c1-11-7-8-13(9-11,10-14)12-5-3-2-4-6-12/h11-12,14H,2-10H2,1H3/t11-,13+/m1/s1 |
| InChIKey | RREWZXOHXWBXGF-YPMHNXCESA-N |
| XLogP | 3.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |