C9H16O2 — CID 131201463
(3aS,6aS)-6a-(hydroxymethyl)-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-ol (PubChem CID 131201463) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (3aS,6aS)-6a-(hydroxymethyl)-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-ol.
| Compound Name | (3aS,6aS)-6a-(hydroxymethyl)-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-ol |
|---|---|
| PubChem CID | 131201463 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (3aS,6aS)-6a-(hydroxymethyl)-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-ol |
| SMILES | OC[C@]12CCC[C@H]1CC(O)C2 |
| InChI | InChI=1S/C9H16O2/c10-6-9-3-1-2-7(9)4-8(11)5-9/h7-8,10-11H,1-6H2/t7-,8?,9+/m0/s1 |
| InChIKey | NYHKPACSHPTXQL-UBGVJBJISA-N |
| XLogP | 0.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |