C16H30O2 — CID 139068492
(1R,11R,15S)-1-(hydroxymethyl)bicyclo[9.3.1]pentadecan-15-ol (PubChem CID 139068492) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (1R,11R,15S)-1-(hydroxymethyl)bicyclo[9.3.1]pentadecan-15-ol.
| Compound Name | (1R,11R,15S)-1-(hydroxymethyl)bicyclo[9.3.1]pentadecan-15-ol |
|---|---|
| PubChem CID | 139068492 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (1R,11R,15S)-1-(hydroxymethyl)bicyclo[9.3.1]pentadecan-15-ol |
| SMILES | OC[C@@]12CCCCCCCCC[C@H](CCC1)[C@@H]2O |
| InChI | InChI=1S/C16H30O2/c17-13-16-11-7-5-3-1-2-4-6-9-14(15(16)18)10-8-12-16/h14-15,17-18H,1-13H2/t14-,15+,16-/m1/s1 |
| InChIKey | CRZBPRDJNBFSSQ-OWCLPIDISA-N |
| XLogP | 3.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |