C9H18ClNO — CID 55282198
[(3aR,7aR)-1,2,3,4,5,6,7,7a-octahydroisoindol-3a-yl]methanol;hydrochloride (PubChem CID 55282198) has the molecular formula C9H18ClNO and a molecular weight of 191.70 g/mol. Its IUPAC name is [(3aR,7aR)-1,2,3,4,5,6,7,7a-octahydroisoindol-3a-yl]methanol;hydrochloride.
| Compound Name | [(3aR,7aR)-1,2,3,4,5,6,7,7a-octahydroisoindol-3a-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 55282198 |
| Molecular Formula | C9H18ClNO |
| Molecular Weight | 191.70 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | [(3aR,7aR)-1,2,3,4,5,6,7,7a-octahydroisoindol-3a-yl]methanol;hydrochloride |
| SMILES | Cl.OC[C@]12CCCC[C@H]1CNC2 |
| InChI | InChI=1S/C9H17NO.ClH/c11-7-9-4-2-1-3-8(9)5-10-6-9;/h8,10-11H,1-7H2;1H/t8-,9+;/m0./s1 |
| InChIKey | PQFQTHPPKRDTMU-OULXEKPRSA-N |
| XLogP | 1.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.70 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |