C9H18N2 — CID 155095679
[(3aR,7aS)-1,2,3,4,5,6,7,7a-octahydroisoindol-3a-yl]methanamine (PubChem CID 155095679) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is [(3aR,7aS)-1,2,3,4,5,6,7,7a-octahydroisoindol-3a-yl]methanamine.
| Compound Name | [(3aR,7aS)-1,2,3,4,5,6,7,7a-octahydroisoindol-3a-yl]methanamine |
|---|---|
| PubChem CID | 155095679 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | [(3aR,7aS)-1,2,3,4,5,6,7,7a-octahydroisoindol-3a-yl]methanamine |
| SMILES | NC[C@@]12CCCC[C@@H]1CNC2 |
| InChI | InChI=1S/C9H18N2/c10-6-9-4-2-1-3-8(9)5-11-7-9/h8,11H,1-7,10H2/t8-,9-/m1/s1 |
| InChIKey | NVXQOSKPWPQCIH-RKDXNWHRSA-N |
| XLogP | 0.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |