2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid

C9H15NO2 — CID 18335043

IUPAC2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid
SMILESO=C(O)CC12CCCC1CNC2
InChIInChI=1S/C9H15NO2/c11-8(12)4-9-3-1-2-7(9)5-10-6-9/h7,10H,1-6H2,(H,11,12)
InChIKeyWWNDWXDKPDXBEN-UHFFFAOYSA-N
MW169.22 g/mol
LogP0.85
Rot. Bonds2

About 2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid

2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid (PubChem CID 18335043) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid.

Molecular Properties

Compound Name2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid
PubChem CID18335043
Molecular FormulaC9H15NO2
Molecular Weight169.22 g/mol
Exact Mass169.11
IUPAC Name2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid
SMILESO=C(O)CC12CCCC1CNC2
InChIInChI=1S/C9H15NO2/c11-8(12)4-9-3-1-2-7(9)5-10-6-9/h7,10H,1-6H2,(H,11,12)
InChIKeyWWNDWXDKPDXBEN-UHFFFAOYSA-N
XLogP0.85
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.22
LogP ≤ 50.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid?
The IUPAC name of 2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid (CID 18335043) is 2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid.
What is the SMILES notation for 2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid?
The canonical SMILES for 2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid is O=C(O)CC12CCCC1CNC2.
What is the InChIKey of 2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid?
The InChIKey is WWNDWXDKPDXBEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c11-8(12)4-9-3-1-2-7(9)5-10-6-9/h7,10H,1-6H2,(H,11,12).
What are the key properties of 2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid?
2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid has a molecular weight of 169.22 g/mol, XLogP of 0.85, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl)acetic acid is sourced from PubChem (CID 18335043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).