C15H19Cl2N — CID 53392851
(3aR,7aR)-7a-[(3,4-dichlorophenyl)methyl]-1,2,3,3a,4,5,6,7-octahydroisoindole (PubChem CID 53392851) has the molecular formula C15H19Cl2N and a molecular weight of 284.23 g/mol. Its IUPAC name is (3aR,7aR)-7a-[(3,4-dichlorophenyl)methyl]-1,2,3,3a,4,5,6,7-octahydroisoindole.
| Compound Name | (3aR,7aR)-7a-[(3,4-dichlorophenyl)methyl]-1,2,3,3a,4,5,6,7-octahydroisoindole |
|---|---|
| PubChem CID | 53392851 |
| Molecular Formula | C15H19Cl2N |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (3aR,7aR)-7a-[(3,4-dichlorophenyl)methyl]-1,2,3,3a,4,5,6,7-octahydroisoindole |
| SMILES | Clc1ccc(C[C@]23CCCC[C@H]2CNC3)cc1Cl |
| InChI | InChI=1S/C15H19Cl2N/c16-13-5-4-11(7-14(13)17)8-15-6-2-1-3-12(15)9-18-10-15/h4-5,7,12,18H,1-3,6,8-10H2/t12-,15-/m0/s1 |
| InChIKey | MEAWOAPXKTVYPU-WFASDCNBSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |