C13H26O4Si — CID 134970429
2-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxyoxan-2-yl]acetaldehyde (PubChem CID 134970429) has the molecular formula C13H26O4Si and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxyoxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxyoxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 134970429 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxyoxan-2-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(O)O[C@H](CC=O)C1 |
| InChI | InChI=1S/C13H26O4Si/c1-13(2,3)18(4,5)17-11-8-10(6-7-14)16-12(15)9-11/h7,10-12,15H,6,8-9H2,1-5H3/t10-,11?,12?/m1/s1 |
| InChIKey | XKPWGVWEFPACGL-VOMCLLRMSA-N |
| XLogP | 2.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|