C22H30O4 — CID 134970663
[(1E)-1-[(3aS,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydroindeno[5,4-f]chromen-1-ylidene]ethyl] acetate (PubChem CID 134970663) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(1E)-1-[(3aS,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydroindeno[5,4-f]chromen-1-ylidene]ethyl] acetate.
| Compound Name | [(1E)-1-[(3aS,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydroindeno[5,4-f]chromen-1-ylidene]ethyl] acetate |
|---|---|
| PubChem CID | 134970663 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(1E)-1-[(3aS,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydroindeno[5,4-f]chromen-1-ylidene]ethyl] acetate |
| SMILES | CC(=O)O/C(C)=C1\CC[C@H]2C3CC=C4OC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H30O4/c1-13(25-14(2)23)16-6-7-17-15-5-8-19-22(4,12-10-20(24)26-19)18(15)9-11-21(16,17)3/h8,15,17-18H,5-7,9-12H2,1-4H3/b16-13+/t15?,17-,18-,21+,22+/m0/s1 |
| InChIKey | VEQPRUXOZPPKJC-OSJQXADGSA-N |
| XLogP | 4.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|