C18H32O4Si — CID 134971088
(2'S,4S)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[5,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-4,1'-cyclopentane]-6-one (PubChem CID 134971088) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is (2'S,4S)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[5,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-4,1'-cyclopentane]-6-one.
| Compound Name | (2'S,4S)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[5,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-4,1'-cyclopentane]-6-one |
|---|---|
| PubChem CID | 134971088 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | (2'S,4S)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[5,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-4,1'-cyclopentane]-6-one |
| SMILES | CC1(C)OC2C(=O)C[C@@]3(CCC[C@@H]3O[Si](C)(C)C(C)(C)C)C2O1 |
| InChI | InChI=1S/C18H32O4Si/c1-16(2,3)23(6,7)22-13-9-8-10-18(13)11-12(19)14-15(18)21-17(4,5)20-14/h13-15H,8-11H2,1-7H3/t13-,14?,15?,18+/m0/s1 |
| InChIKey | KRGRTSIQJCMHQO-FAYHIZQSSA-N |
| XLogP | 4.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|