C17H30O5Si — CID 11186941
(2'S,3aS,4S,6aR)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[3a,6a-dihydrofuro[3,4-d][1,3]dioxole-4,1'-cyclopentane]-6-one (PubChem CID 11186941) has the molecular formula C17H30O5Si and a molecular weight of 342.51 g/mol. Its IUPAC name is (2'S,3aS,4S,6aR)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[3a,6a-dihydrofuro[3,4-d][1,3]dioxole-4,1'-cyclopentane]-6-one.
| Compound Name | (2'S,3aS,4S,6aR)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[3a,6a-dihydrofuro[3,4-d][1,3]dioxole-4,1'-cyclopentane]-6-one |
|---|---|
| PubChem CID | 11186941 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (2'S,3aS,4S,6aR)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[3a,6a-dihydrofuro[3,4-d][1,3]dioxole-4,1'-cyclopentane]-6-one |
| SMILES | CC1(C)O[C@H]2C(=O)O[C@@]3(CCC[C@@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C17H30O5Si/c1-15(2,3)23(6,7)22-11-9-8-10-17(11)13-12(14(18)21-17)19-16(4,5)20-13/h11-13H,8-10H2,1-7H3/t11-,12+,13-,17+/m0/s1 |
| InChIKey | IPFFGZALYWDRJN-PFHKOEEOSA-N |
| XLogP | 3.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|