C22H24O5S — CID 134971323
[(3R,4R,6S)-3-benzoyloxy-6-ethylsulfanyl-2-methyloxan-4-yl] benzoate (PubChem CID 134971323) has the molecular formula C22H24O5S and a molecular weight of 400.50 g/mol. Its IUPAC name is [(3R,4R,6S)-3-benzoyloxy-6-ethylsulfanyl-2-methyloxan-4-yl] benzoate.
| Compound Name | [(3R,4R,6S)-3-benzoyloxy-6-ethylsulfanyl-2-methyloxan-4-yl] benzoate |
|---|---|
| PubChem CID | 134971323 |
| Molecular Formula | C22H24O5S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [(3R,4R,6S)-3-benzoyloxy-6-ethylsulfanyl-2-methyloxan-4-yl] benzoate |
| SMILES | CCS[C@H]1C[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)C(C)O1 |
| InChI | InChI=1S/C22H24O5S/c1-3-28-19-14-18(26-21(23)16-10-6-4-7-11-16)20(15(2)25-19)27-22(24)17-12-8-5-9-13-17/h4-13,15,18-20H,3,14H2,1-2H3/t15?,18-,19+,20-/m1/s1 |
| InChIKey | IQAGUHGELGLRNT-FOUFQHLJSA-N |
| XLogP | 4.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |