C13H22O2 — CID 134971769
3-[(2S)-5-tert-butyl-2-methyl-2H-furan-5-yl]but-3-en-2-ol (PubChem CID 134971769) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-[(2S)-5-tert-butyl-2-methyl-2H-furan-5-yl]but-3-en-2-ol.
| Compound Name | 3-[(2S)-5-tert-butyl-2-methyl-2H-furan-5-yl]but-3-en-2-ol |
|---|---|
| PubChem CID | 134971769 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 3-[(2S)-5-tert-butyl-2-methyl-2H-furan-5-yl]but-3-en-2-ol |
| SMILES | C=C(C(C)O)C1(C(C)(C)C)C=C[C@H](C)O1 |
| InChI | InChI=1S/C13H22O2/c1-9-7-8-13(15-9,12(4,5)6)10(2)11(3)14/h7-9,11,14H,2H2,1,3-6H3/t9-,11?,13?/m0/s1 |
| InChIKey | NUBVXRVUXRQIHY-FJJSSXBZSA-N |
| XLogP | 2.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|