C18H22BrNO5 — CID 134971777
methyl N-[(2-bromophenyl)methyl]-N-[(5R,6R)-5-ethenyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]carbamate (PubChem CID 134971777) has the molecular formula C18H22BrNO5 and a molecular weight of 412.28 g/mol. Its IUPAC name is methyl N-[(2-bromophenyl)methyl]-N-[(5R,6R)-5-ethenyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]carbamate.
| Compound Name | methyl N-[(2-bromophenyl)methyl]-N-[(5R,6R)-5-ethenyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]carbamate |
|---|---|
| PubChem CID | 134971777 |
| Molecular Formula | C18H22BrNO5 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | methyl N-[(2-bromophenyl)methyl]-N-[(5R,6R)-5-ethenyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]carbamate |
| SMILES | C=C[C@H]1OC2OC(C)(C)OC2[C@@H]1N(Cc1ccccc1Br)C(=O)OC |
| InChI | InChI=1S/C18H22BrNO5/c1-5-13-14(15-16(23-13)25-18(2,3)24-15)20(17(21)22-4)10-11-8-6-7-9-12(11)19/h5-9,13-16H,1,10H2,2-4H3/t13-,14-,15?,16?/m1/s1 |
| InChIKey | HFZXDHOXUNICCN-WXLSXGNJSA-N |
| XLogP | 3.45 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|