C22H27NO4S — CID 134971791
tert-butyl (4R)-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidine-3-carboxylate (PubChem CID 134971791) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is tert-butyl (4R)-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 134971791 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | tert-butyl (4R)-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C(=O)OC(C)(C)C)[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C22H27NO4S/c1-16-10-12-18(13-11-16)28(25,26)23-14-19(17-8-6-5-7-9-17)20(15-23)21(24)27-22(2,3)4/h5-13,19-20H,14-15H2,1-4H3/t19-,20?/m0/s1 |
| InChIKey | JTGNLIIZFYDQJY-XJDOXCRVSA-N |
| XLogP | 3.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |