C31H44O18 — CID 134972318
[(3R,6S)-3,4,5-triacetyloxy-6-[2-acetyloxy-2-[(2S,5S)-3,4-diacetyloxy-5-pent-4-enoxyoxolan-2-yl]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 134972318) has the molecular formula C31H44O18 and a molecular weight of 704.67 g/mol. Its IUPAC name is [(3R,6S)-3,4,5-triacetyloxy-6-[2-acetyloxy-2-[(2S,5S)-3,4-diacetyloxy-5-pent-4-enoxyoxolan-2-yl]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-3,4,5-triacetyloxy-6-[2-acetyloxy-2-[(2S,5S)-3,4-diacetyloxy-5-pent-4-enoxyoxolan-2-yl]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134972318 |
| Molecular Formula | C31H44O18 |
| Molecular Weight | 704.67 g/mol |
| Exact Mass | 704.25 |
| IUPAC Name | [(3R,6S)-3,4,5-triacetyloxy-6-[2-acetyloxy-2-[(2S,5S)-3,4-diacetyloxy-5-pent-4-enoxyoxolan-2-yl]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | C=CCCCO[C@H]1O[C@@H](C(CO[C@H]2OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C2OC(C)=O)OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C31H44O18/c1-9-10-11-12-39-30-28(46-20(7)37)27(45-19(6)36)25(49-30)22(42-16(3)33)14-41-31-29(47-21(8)38)26(44-18(5)35)24(43-17(4)34)23(48-31)13-40-15(2)32/h9,22-31H,1,10-14H2,2-8H3/t22?,23?,24-,25+,26?,27?,28?,29?,30+,31+/m1/s1 |
| InChIKey | JHAWOSKQNXPMEL-KCFBTLDHSA-N |
| XLogP | 0.59 |
| TPSA | 221.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.67 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|