C16H24O8 — CID 11439341
[(2S,3R,4S,5R,6S)-4,5-diacetyloxy-6-methoxy-3-prop-2-enyloxan-2-yl]methyl acetate (PubChem CID 11439341) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6S)-4,5-diacetyloxy-6-methoxy-3-prop-2-enyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5R,6S)-4,5-diacetyloxy-6-methoxy-3-prop-2-enyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11439341 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [(2S,3R,4S,5R,6S)-4,5-diacetyloxy-6-methoxy-3-prop-2-enyloxan-2-yl]methyl acetate |
| SMILES | C=CC[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC)O[C@@H]1COC(C)=O |
| InChI | InChI=1S/C16H24O8/c1-6-7-12-13(8-21-9(2)17)24-16(20-5)15(23-11(4)19)14(12)22-10(3)18/h6,12-16H,1,7-8H2,2-5H3/t12-,13-,14+,15-,16+/m1/s1 |
| InChIKey | HSFVGUWBWYEOKM-LJIZCISZSA-N |
| XLogP | 0.98 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|