C9H15N — CID 134972345
1,2-bis(ethenyl)-2-methylpyrrolidine (PubChem CID 134972345) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-2-methylpyrrolidine.
| Compound Name | 1,2-bis(ethenyl)-2-methylpyrrolidine |
|---|---|
| PubChem CID | 134972345 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 1,2-bis(ethenyl)-2-methylpyrrolidine |
| SMILES | C=CN1CCCC1(C)C=C |
| InChI | InChI=1S/C9H15N/c1-4-9(3)7-6-8-10(9)5-2/h4-5H,1-2,6-8H2,3H3 |
| InChIKey | FJOQYQAGOKVMGQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|