C10H12N2 — CID 134972360
7,8,9,9a-tetrahydro-5H-imidazo[2,1-a]isoindole (PubChem CID 134972360) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 7,8,9,9a-tetrahydro-5H-imidazo[2,1-a]isoindole.
| Compound Name | 7,8,9,9a-tetrahydro-5H-imidazo[2,1-a]isoindole |
|---|---|
| PubChem CID | 134972360 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 7,8,9,9a-tetrahydro-5H-imidazo[2,1-a]isoindole |
| SMILES | C1=C2Cn3ccnc3C2CCC1 |
| InChI | InChI=1S/C10H12N2/c1-2-4-9-8(3-1)7-12-6-5-11-10(9)12/h3,5-6,9H,1-2,4,7H2 |
| InChIKey | CPWCZVXLDAOANC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|