C13H19F3N2 — CID 151519521
2-(2,6-dimethylhept-5-enyl)-1-(trifluoromethyl)imidazole (PubChem CID 151519521) has the molecular formula C13H19F3N2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-(2,6-dimethylhept-5-enyl)-1-(trifluoromethyl)imidazole.
| Compound Name | 2-(2,6-dimethylhept-5-enyl)-1-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 151519521 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-(2,6-dimethylhept-5-enyl)-1-(trifluoromethyl)imidazole |
| SMILES | CC(C)=CCCC(C)Cc1nccn1C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2/c1-10(2)5-4-6-11(3)9-12-17-7-8-18(12)13(14,15)16/h5,7-8,11H,4,6,9H2,1-3H3 |
| InChIKey | PUELMEVHBIPFDS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|