C17H24BrNO — CID 134972440
(4S)-2-[[3-(bromomethyl)-2,4,6-trimethylphenyl]methyl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 134972440) has the molecular formula C17H24BrNO and a molecular weight of 338.29 g/mol. Its IUPAC name is (4S)-2-[[3-(bromomethyl)-2,4,6-trimethylphenyl]methyl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-[[3-(bromomethyl)-2,4,6-trimethylphenyl]methyl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 134972440 |
| Molecular Formula | C17H24BrNO |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (4S)-2-[[3-(bromomethyl)-2,4,6-trimethylphenyl]methyl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1cc(C)c(CC2=N[C@@H](C(C)C)CO2)c(C)c1CBr |
| InChI | InChI=1S/C17H24BrNO/c1-10(2)16-9-20-17(19-16)7-14-11(3)6-12(4)15(8-18)13(14)5/h6,10,16H,7-9H2,1-5H3/t16-/m1/s1 |
| InChIKey | GRQDPASAPKZUDC-MRXNPFEDSA-N |
| XLogP | 4.50 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|