C16H23NO — CID 20813396
4-methyl-2-(4-phenylhexan-2-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 20813396) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 4-methyl-2-(4-phenylhexan-2-yl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-methyl-2-(4-phenylhexan-2-yl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 20813396 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 4-methyl-2-(4-phenylhexan-2-yl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCC(CC(C)C1=NC(C)CO1)c1ccccc1 |
| InChI | InChI=1S/C16H23NO/c1-4-14(15-8-6-5-7-9-15)10-12(2)16-17-13(3)11-18-16/h5-9,12-14H,4,10-11H2,1-3H3 |
| InChIKey | CIRKXVLHPVWQNQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |