C12H13NO — CID 69039732
2-benzyl-4-ethenyl-4,5-dihydro-1,3-oxazole (PubChem CID 69039732) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-benzyl-4-ethenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-benzyl-4-ethenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 69039732 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-benzyl-4-ethenyl-4,5-dihydro-1,3-oxazole |
| SMILES | C=CC1COC(Cc2ccccc2)=N1 |
| InChI | InChI=1S/C12H13NO/c1-2-11-9-14-12(13-11)8-10-6-4-3-5-7-10/h2-7,11H,1,8-9H2 |
| InChIKey | VNEZTRYZDOIVLF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|