C11H12FNO — CID 101184937
2-[2-(4-fluorophenyl)ethyl]-4,5-dihydro-1,3-oxazole (PubChem CID 101184937) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)ethyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-[2-(4-fluorophenyl)ethyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 101184937 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-[2-(4-fluorophenyl)ethyl]-4,5-dihydro-1,3-oxazole |
| SMILES | Fc1ccc(CCC2=NCCO2)cc1 |
| InChI | InChI=1S/C11H12FNO/c12-10-4-1-9(2-5-10)3-6-11-13-7-8-14-11/h1-2,4-5H,3,6-8H2 |
| InChIKey | XFYLUUWYEZYNMS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |