C20H36OSi — CID 134972664
tert-butyl-[[7-(2,2-dimethylpent-4-enyl)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-dimethylsilane (PubChem CID 134972664) has the molecular formula C20H36OSi and a molecular weight of 320.59 g/mol. Its IUPAC name is tert-butyl-[[7-(2,2-dimethylpent-4-enyl)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[7-(2,2-dimethylpent-4-enyl)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 134972664 |
| Molecular Formula | C20H36OSi |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | tert-butyl-[[7-(2,2-dimethylpent-4-enyl)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-dimethylsilane |
| SMILES | C=CCC(C)(C)CC1(O[Si](C)(C)C(C)(C)C)C2C=CC1CC2 |
| InChI | InChI=1S/C20H36OSi/c1-9-14-19(5,6)15-20(16-10-11-17(20)13-12-16)21-22(7,8)18(2,3)4/h9-11,16-17H,1,12-15H2,2-8H3 |
| InChIKey | SWGZBYKTJBAMDK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|