C16H18O4 — CID 134972711
6,7a,11-trimethyl-2,3,5,8-tetrahydrobenzo[i][1,4]benzodioxepine-7,9-dione (PubChem CID 134972711) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 6,7a,11-trimethyl-2,3,5,8-tetrahydrobenzo[i][1,4]benzodioxepine-7,9-dione.
| Compound Name | 6,7a,11-trimethyl-2,3,5,8-tetrahydrobenzo[i][1,4]benzodioxepine-7,9-dione |
|---|---|
| PubChem CID | 134972711 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 6,7a,11-trimethyl-2,3,5,8-tetrahydrobenzo[i][1,4]benzodioxepine-7,9-dione |
| SMILES | CC1=CC(=O)CC2(C)C(=O)C(C)=C3COCCOC3=C12 |
| InChI | InChI=1S/C16H18O4/c1-9-6-11(17)7-16(3)13(9)14-12(10(2)15(16)18)8-19-4-5-20-14/h6H,4-5,7-8H2,1-3H3 |
| InChIKey | BJZNXRLQZRARKF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |