C16H18O3 — CID 134972626
5,6a,10-trimethyl-2,3,4,7-tetrahydrobenzo[h]chromene-6,8-dione (PubChem CID 134972626) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 5,6a,10-trimethyl-2,3,4,7-tetrahydrobenzo[h]chromene-6,8-dione.
| Compound Name | 5,6a,10-trimethyl-2,3,4,7-tetrahydrobenzo[h]chromene-6,8-dione |
|---|---|
| PubChem CID | 134972626 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 5,6a,10-trimethyl-2,3,4,7-tetrahydrobenzo[h]chromene-6,8-dione |
| SMILES | CC1=CC(=O)CC2(C)C(=O)C(C)=C3CCCOC3=C12 |
| InChI | InChI=1S/C16H18O3/c1-9-7-11(17)8-16(3)13(9)14-12(5-4-6-19-14)10(2)15(16)18/h7H,4-6,8H2,1-3H3 |
| InChIKey | GGALDNUQOPPTCU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |