C19H26O3 — CID 134973471
(3aR)-3-(1-methoxyprop-1-en-2-yl)-2,3a,7-trimethyl-1-propan-2-yloxy-4H-inden-5-one (PubChem CID 134973471) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (3aR)-3-(1-methoxyprop-1-en-2-yl)-2,3a,7-trimethyl-1-propan-2-yloxy-4H-inden-5-one.
| Compound Name | (3aR)-3-(1-methoxyprop-1-en-2-yl)-2,3a,7-trimethyl-1-propan-2-yloxy-4H-inden-5-one |
|---|---|
| PubChem CID | 134973471 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (3aR)-3-(1-methoxyprop-1-en-2-yl)-2,3a,7-trimethyl-1-propan-2-yloxy-4H-inden-5-one |
| SMILES | COC=C(C)C1=C(C)C(OC(C)C)=C2C(C)=CC(=O)C[C@]12C |
| InChI | InChI=1S/C19H26O3/c1-11(2)22-18-14(5)16(13(4)10-21-7)19(6)9-15(20)8-12(3)17(18)19/h8,10-11H,9H2,1-7H3/t19-/m1/s1 |
| InChIKey | QFYHHGOIGXCTTL-LJQANCHMSA-N |
| XLogP | 4.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|