C15H12ClN3SY-2 — CID 134972860
benzene;4-(2-chlorophenyl)-3-methanidyl-1H-1,2,4-triazole-5-thione;yttrium (PubChem CID 134972860) has the molecular formula C15H12ClN3SY-2 and a molecular weight of 390.71 g/mol. Its IUPAC name is benzene;4-(2-chlorophenyl)-3-methanidyl-1H-1,2,4-triazole-5-thione;yttrium.
| Compound Name | benzene;4-(2-chlorophenyl)-3-methanidyl-1H-1,2,4-triazole-5-thione;yttrium |
|---|---|
| PubChem CID | 134972860 |
| Molecular Formula | C15H12ClN3SY-2 |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | benzene;4-(2-chlorophenyl)-3-methanidyl-1H-1,2,4-triazole-5-thione;yttrium |
| SMILES | [CH2-]c1n[nH]c(=S)n1-c1ccccc1Cl.[Y].[c-]1ccccc1 |
| InChI | InChI=1S/C9H7ClN3S.C6H5.Y/c1-6-11-12-9(14)13(6)8-5-3-2-4-7(8)10;1-2-4-6-5-3-1;/h2-5H,1H2,(H,12,14);1-5H;/q2*-1; |
| InChIKey | VLYUEIDMXAXKJJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|