C11H18O2 — CID 134973228
[(2S)-2-[(2E)-6-methylhepta-2,5-dienyl]oxiran-2-yl]methanol (PubChem CID 134973228) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is [(2S)-2-[(2E)-6-methylhepta-2,5-dienyl]oxiran-2-yl]methanol.
| Compound Name | [(2S)-2-[(2E)-6-methylhepta-2,5-dienyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 134973228 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | [(2S)-2-[(2E)-6-methylhepta-2,5-dienyl]oxiran-2-yl]methanol |
| SMILES | CC(C)=CC/C=C/C[C@]1(CO)CO1 |
| InChI | InChI=1S/C11H18O2/c1-10(2)6-4-3-5-7-11(8-12)9-13-11/h3,5-6,12H,4,7-9H2,1-2H3/b5-3+/t11-/m0/s1 |
| InChIKey | AYWWLIPWUBGWFY-TZNOJPMFSA-N |
| XLogP | 2.05 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|