C10H18O3 — CID 11789929
(Z)-5-[(2R,3R)-2-(methoxymethyl)-3-methyloxiran-2-yl]pent-3-en-1-ol (PubChem CID 11789929) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (Z)-5-[(2R,3R)-2-(methoxymethyl)-3-methyloxiran-2-yl]pent-3-en-1-ol.
| Compound Name | (Z)-5-[(2R,3R)-2-(methoxymethyl)-3-methyloxiran-2-yl]pent-3-en-1-ol |
|---|---|
| PubChem CID | 11789929 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (Z)-5-[(2R,3R)-2-(methoxymethyl)-3-methyloxiran-2-yl]pent-3-en-1-ol |
| SMILES | COC[C@@]1(C/C=C\CCO)O[C@@H]1C |
| InChI | InChI=1S/C10H18O3/c1-9-10(13-9,8-12-2)6-4-3-5-7-11/h3-4,9,11H,5-8H2,1-2H3/b4-3-/t9-,10-/m1/s1 |
| InChIKey | CKSLNMQAEVFAIC-HWKXXFMVSA-N |
| XLogP | 1.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|