About [3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol
[3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol (PubChem CID 72770693) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is [3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol.
Molecular Properties
| Compound Name | [3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol |
| PubChem CID | 72770693 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | [3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol |
| SMILES | CC(C)=CCCC(C)=CCCC1(C)OC1CO |
| InChI | InChI=1S/C15H26O2/c1-12(2)7-5-8-13(3)9-6-10-15(4)14(11-16)17-15/h7,9,14,16H,5-6,8,10-11H2,1-4H3 |
| InChIKey | QMBUSAARJPUREI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol?
The IUPAC name of [3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol (CID 72770693) is [3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol.
What is the SMILES notation for [3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol?
The canonical SMILES for [3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol is CC(C)=CCCC(C)=CCCC1(C)OC1CO.
What is the InChIKey of [3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol?
The InChIKey is QMBUSAARJPUREI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2/c1-12(2)7-5-8-13(3)9-6-10-15(4)14(11-16)17-15/h7,9,14,16H,5-6,8,10-11H2,1-4H3.
What are the key properties of [3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol?
[3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol has a molecular weight of 238.37 g/mol, XLogP of 3.61, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4,8-dimethylnona-3,7-dienyl)-3-methyloxiran-2-yl]methanol is sourced from PubChem (CID 72770693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).